상품명칭 |
3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane |
영문 이름 |
3,9-Divinyl-2,4,8,10-tetraoxaspiro[5.5]undecane; 3,9-Divinylspirobis(m-dioxan); 3,9-diethenyl-2,4,8,10-tetraoxaspiro[5.5]undecane; 3,9-Divinylspirobi(m-dioxane); 3,9-Divinyl-2,4,8,10-tetraoxaspiro(5.5)undecane |
분자식 |
C11H16O4 |
분자량 |
212.2423 |
InChI |
InChI=1/C11H16O4/c1-3-9-12-5-11(6-13-9)7-14-10(4-2)15-8-11/h3-4,9-10H,1-2,5-8H2 |
cas번호 |
78-19-3 |
EC번호 |
201-092-7 |
분자 구조 |
|
밀도 |
1.11g/cm3 |
녹는 점 |
43-46℃ |
비등점 |
284.4°C at 760 mmHg |
굴절 지수 |
1.493 |
인화점 |
106.6°C |
증기압 |
0.00512mmHg at 25°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|